C19H29N5O3 — CID 46937168
(2R,6S)-6-[(3,4,5-trimethoxy-N-methylanilino)methyl]-1,2,5,6,7,8-hexahydroquinazoline-2,4-diamine (PubChem CID 46937168) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2R,6S)-6-[(3,4,5-trimethoxy-N-methylanilino)methyl]-1,2,5,6,7,8-hexahydroquinazoline-2,4-diamine.
| Compound Name | (2R,6S)-6-[(3,4,5-trimethoxy-N-methylanilino)methyl]-1,2,5,6,7,8-hexahydroquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 46937168 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (2R,6S)-6-[(3,4,5-trimethoxy-N-methylanilino)methyl]-1,2,5,6,7,8-hexahydroquinazoline-2,4-diamine |
| SMILES | COc1cc(N(C)C[C@H]2CCC3=C(C2)C(N)=N[C@H](N)N3)cc(OC)c1OC |
| InChI | InChI=1S/C19H29N5O3/c1-24(12-8-15(25-2)17(27-4)16(9-12)26-3)10-11-5-6-14-13(7-11)18(20)23-19(21)22-14/h8-9,11,19,22H,5-7,10,21H2,1-4H3,(H2,20,23)/t11-,19+/m0/s1 |
| InChIKey | JJWPLCQODKLEHY-JEOXALJRSA-N |
| XLogP | 1.41 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|