C15H25NO — CID 46937360
(2E,6E,10R,11R)-10-amino-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one (PubChem CID 46937360) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2E,6E,10R,11R)-10-amino-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one.
| Compound Name | (2E,6E,10R,11R)-10-amino-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one |
|---|---|
| PubChem CID | 46937360 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2E,6E,10R,11R)-10-amino-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one |
| SMILES | C/C1=C\CC(C)(C)/C=C/C(=O)[C@H](C)[C@H](N)CC1 |
| InChI | InChI=1S/C15H25NO/c1-11-5-6-13(16)12(2)14(17)8-10-15(3,4)9-7-11/h7-8,10,12-13H,5-6,9,16H2,1-4H3/b10-8+,11-7+/t12-,13-/m1/s1 |
| InChIKey | SXHWJVDYMLLXKF-QRDKOGIESA-N |
| XLogP | 3.23 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|