About hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane
hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane (PubChem CID 46937425) has the molecular formula C19H18N2O3S
and a molecular weight of 354.43 g/mol. Its IUPAC name is hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane.
Molecular Properties
| Compound Name | hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane |
| PubChem CID | 46937425 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane |
| SMILES | Cc1nnc(-c2ccc3occ(-c4ccc(S(C)(C)O)cc4)c3c2)o1 |
| InChI | InChI=1S/C19H18N2O3S/c1-12-20-21-19(24-12)14-6-9-18-16(10-14)17(11-23-18)13-4-7-15(8-5-13)25(2,3)22/h4-11,22H,1-3H3 |
| InChIKey | QQJDYKSYVWMBKE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane?
The IUPAC name of hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane (CID 46937425) is hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane.
What is the SMILES notation for hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane?
The canonical SMILES for hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane is Cc1nnc(-c2ccc3occ(-c4ccc(S(C)(C)O)cc4)c3c2)o1.
What is the InChIKey of hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane?
The InChIKey is QQJDYKSYVWMBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3S/c1-12-20-21-19(24-12)14-6-9-18-16(10-14)17(11-23-18)13-4-7-15(8-5-13)25(2,3)22/h4-11,22H,1-3H3.
What are the key properties of hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane?
hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane has a molecular weight of 354.43 g/mol, XLogP of 5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-dimethyl-[4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzofuran-3-yl]phenyl]-λ4-sulfane is sourced from PubChem (CID 46937425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).