C14H13F3N2O2 — CID 46937480
5-[(2R,4S)-2-(2,4,5-trifluorophenyl)piperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 46937480) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is 5-[(2R,4S)-2-(2,4,5-trifluorophenyl)piperidin-4-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[(2R,4S)-2-(2,4,5-trifluorophenyl)piperidin-4-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 46937480 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-[(2R,4S)-2-(2,4,5-trifluorophenyl)piperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | O=c1cc([C@H]2CCN[C@@H](c3cc(F)c(F)cc3F)C2)o[nH]1 |
| InChI | InChI=1S/C14H13F3N2O2/c15-9-5-11(17)10(16)4-8(9)12-3-7(1-2-18-12)13-6-14(20)19-21-13/h4-7,12,18H,1-3H2,(H,19,20)/t7-,12+/m0/s1 |
| InChIKey | XUWSZERHZIVZHS-JVXZTZIISA-N |
| XLogP | 2.59 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|