C20H23IN4O2 — CID 46937923
methyl 2-[3-[(4-iodo-2-methyl-4,5,6,8-tetrahydro-1H-pyrido[3,4-d]pyrimidin-7-yl)methyl]indol-1-yl]acetate (PubChem CID 46937923) has the molecular formula C20H23IN4O2 and a molecular weight of 478.33 g/mol. Its IUPAC name is methyl 2-[3-[(4-iodo-2-methyl-4,5,6,8-tetrahydro-1H-pyrido[3,4-d]pyrimidin-7-yl)methyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[3-[(4-iodo-2-methyl-4,5,6,8-tetrahydro-1H-pyrido[3,4-d]pyrimidin-7-yl)methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 46937923 |
| Molecular Formula | C20H23IN4O2 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | methyl 2-[3-[(4-iodo-2-methyl-4,5,6,8-tetrahydro-1H-pyrido[3,4-d]pyrimidin-7-yl)methyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(CN2CCC3=C(C2)NC(C)=NC3I)c2ccccc21 |
| InChI | InChI=1S/C20H23IN4O2/c1-13-22-17-11-24(8-7-16(17)20(21)23-13)9-14-10-25(12-19(26)27-2)18-6-4-3-5-15(14)18/h3-6,10,20H,7-9,11-12H2,1-2H3,(H,22,23) |
| InChIKey | RUSPGRHMRZQZNI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|