C33H33F2NO2 — CID 46938015
(11R,13S)-3'-(difluoromethylidene)-13-methyl-11-(4-pyridin-3-ylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one (PubChem CID 46938015) has the molecular formula C33H33F2NO2 and a molecular weight of 513.63 g/mol. Its IUPAC name is (11R,13S)-3'-(difluoromethylidene)-13-methyl-11-(4-pyridin-3-ylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one.
| Compound Name | (11R,13S)-3'-(difluoromethylidene)-13-methyl-11-(4-pyridin-3-ylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one |
|---|---|
| PubChem CID | 46938015 |
| Molecular Formula | C33H33F2NO2 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | (11R,13S)-3'-(difluoromethylidene)-13-methyl-11-(4-pyridin-3-ylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(-c4cccnc4)cc3)C3=C4CCC(=O)C=C4CCC3C1CCC21OCCC1=C(F)F |
| InChI | InChI=1S/C33H33F2NO2/c1-32-18-27(21-6-4-20(5-7-21)23-3-2-15-36-19-23)30-25-11-9-24(37)17-22(25)8-10-26(30)28(32)12-14-33(32)29(31(34)35)13-16-38-33/h2-7,15,17,19,26-28H,8-14,16,18H2,1H3/t26?,27-,28?,32+,33?/m1/s1 |
| InChIKey | DPQWUSDDALKSIH-GCSCOUDUSA-N |
| XLogP | 7.96 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |