C24H19Cl2N8O3+ — CID 46938020
6-(2,6-dichlorophenyl)-8-methyl-2-[[1-[(3-methyl-5-nitroimidazol-4-yl)methyl]pyridin-1-ium-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 46938020) has the molecular formula C24H19Cl2N8O3+ and a molecular weight of 538.38 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-methyl-2-[[1-[(3-methyl-5-nitroimidazol-4-yl)methyl]pyridin-1-ium-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[[1-[(3-methyl-5-nitroimidazol-4-yl)methyl]pyridin-1-ium-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 46938020 |
| Molecular Formula | C24H19Cl2N8O3+ |
| Molecular Weight | 538.38 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[[1-[(3-methyl-5-nitroimidazol-4-yl)methyl]pyridin-1-ium-4-yl]amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cn1cnc([N+](=O)[O-])c1C[n+]1ccc(Nc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)cc1 |
| InChI | InChI=1S/C24H18Cl2N8O3/c1-31-13-28-22(34(36)37)19(31)12-33-8-6-15(7-9-33)29-24-27-11-14-10-16(23(35)32(2)21(14)30-24)20-17(25)4-3-5-18(20)26/h3-11,13H,12H2,1-2H3/p+1 |
| InChIKey | UMQAAMCGROIOBO-UHFFFAOYSA-O |
| XLogP | 4.02 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|