C32H33Cl2N8O4+ — CID 46938026
6-(2,6-dichlorophenyl)-8-methyl-2-[4-[2-[1-[(3-methyl-5-nitroimidazol-4-yl)methyl]piperidin-1-ium-1-yl]ethoxy]anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 46938026) has the molecular formula C32H33Cl2N8O4+ and a molecular weight of 664.57 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-methyl-2-[4-[2-[1-[(3-methyl-5-nitroimidazol-4-yl)methyl]piperidin-1-ium-1-yl]ethoxy]anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[4-[2-[1-[(3-methyl-5-nitroimidazol-4-yl)methyl]piperidin-1-ium-1-yl]ethoxy]anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 46938026 |
| Molecular Formula | C32H33Cl2N8O4+ |
| Molecular Weight | 664.57 g/mol |
| Exact Mass | 663.20 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[4-[2-[1-[(3-methyl-5-nitroimidazol-4-yl)methyl]piperidin-1-ium-1-yl]ethoxy]anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cn1cnc([N+](=O)[O-])c1C[N+]1(CCOc2ccc(Nc3ncc4cc(-c5c(Cl)cccc5Cl)c(=O)n(C)c4n3)cc2)CCCCC1 |
| InChI | InChI=1S/C32H32Cl2N8O4/c1-39-20-36-30(41(44)45)27(39)19-42(13-4-3-5-14-42)15-16-46-23-11-9-22(10-12-23)37-32-35-18-21-17-24(31(43)40(2)29(21)38-32)28-25(33)7-6-8-26(28)34/h6-12,17-18,20H,3-5,13-16,19H2,1-2H3/p+1 |
| InChIKey | YFMYNZASETWRFI-UHFFFAOYSA-O |
| XLogP | 6.27 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|