About 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one
5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 46938036) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one |
| PubChem CID | 46938036 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | O=c1cc([C@@H]2CCN[C@@H](Cc3ccccc3)C2)o[nH]1 |
| InChI | InChI=1S/C15H18N2O2/c18-15-10-14(19-17-15)12-6-7-16-13(9-12)8-11-4-2-1-3-5-11/h1-5,10,12-13,16H,6-9H2,(H,17,18)/t12-,13+/m1/s1 |
| InChIKey | LNFPEBXLWIXQLF-OLZOCXBDSA-N |
| XLogP | 2.05 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one?
The IUPAC name of 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one (CID 46938036) is 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one.
What is the SMILES notation for 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one?
The canonical SMILES for 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one is O=c1cc([C@@H]2CCN[C@@H](Cc3ccccc3)C2)o[nH]1.
What is the InChIKey of 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one?
The InChIKey is LNFPEBXLWIXQLF-OLZOCXBDSA-N. The full InChI is InChI=1S/C15H18N2O2/c18-15-10-14(19-17-15)12-6-7-16-13(9-12)8-11-4-2-1-3-5-11/h1-5,10,12-13,16H,6-9H2,(H,17,18)/t12-,13+/m1/s1.
What are the key properties of 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one?
5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one has a molecular weight of 258.32 g/mol, XLogP of 2.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R,4R)-2-benzylpiperidin-4-yl]-1,2-oxazol-3-one is sourced from PubChem (CID 46938036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).