C25H32O2 — CID 46938441
(1R,3aR,4R,5S,7aS)-3,5-diethyl-1,4,7-trimethyl-5-[(E)-2-phenylethenyl]-3a,7a-dihydro-1H-indene-4-carboxylic acid (PubChem CID 46938441) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is (1R,3aR,4R,5S,7aS)-3,5-diethyl-1,4,7-trimethyl-5-[(E)-2-phenylethenyl]-3a,7a-dihydro-1H-indene-4-carboxylic acid.
| Compound Name | (1R,3aR,4R,5S,7aS)-3,5-diethyl-1,4,7-trimethyl-5-[(E)-2-phenylethenyl]-3a,7a-dihydro-1H-indene-4-carboxylic acid |
|---|---|
| PubChem CID | 46938441 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (1R,3aR,4R,5S,7aS)-3,5-diethyl-1,4,7-trimethyl-5-[(E)-2-phenylethenyl]-3a,7a-dihydro-1H-indene-4-carboxylic acid |
| SMILES | CCC1=C[C@@H](C)[C@@H]2C(C)=C[C@@](/C=C/c3ccccc3)(CC)[C@](C)(C(=O)O)[C@@H]12 |
| InChI | InChI=1S/C25H32O2/c1-6-20-15-17(3)21-18(4)16-25(7-2,24(5,22(20)21)23(26)27)14-13-19-11-9-8-10-12-19/h8-17,21-22H,6-7H2,1-5H3,(H,26,27)/b14-13+/t17-,21-,22+,24+,25+/m1/s1 |
| InChIKey | DGVIYEMUVWSVTP-OXAAXFJDSA-N |
| XLogP | 6.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|