C26H32O2 — CID 46938443
(1R,3aR,4R,5S,7aS)-1,3,4,5,7-pentamethyl-5-[(1E,3E)-2-methyl-4-phenylbuta-1,3-dienyl]-3a,7a-dihydro-1H-indene-4-carboxylic acid (PubChem CID 46938443) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is (1R,3aR,4R,5S,7aS)-1,3,4,5,7-pentamethyl-5-[(1E,3E)-2-methyl-4-phenylbuta-1,3-dienyl]-3a,7a-dihydro-1H-indene-4-carboxylic acid.
| Compound Name | (1R,3aR,4R,5S,7aS)-1,3,4,5,7-pentamethyl-5-[(1E,3E)-2-methyl-4-phenylbuta-1,3-dienyl]-3a,7a-dihydro-1H-indene-4-carboxylic acid |
|---|---|
| PubChem CID | 46938443 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (1R,3aR,4R,5S,7aS)-1,3,4,5,7-pentamethyl-5-[(1E,3E)-2-methyl-4-phenylbuta-1,3-dienyl]-3a,7a-dihydro-1H-indene-4-carboxylic acid |
| SMILES | CC1=C[C@](C)(/C=C(C)/C=C/c2ccccc2)[C@](C)(C(=O)O)[C@H]2C(C)=C[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C26H32O2/c1-17(12-13-21-10-8-7-9-11-21)15-25(5)16-20(4)22-18(2)14-19(3)23(22)26(25,6)24(27)28/h7-16,18,22-23H,1-6H3,(H,27,28)/b13-12+,17-15+/t18-,22-,23+,25+,26+/m1/s1 |
| InChIKey | USZQRGFOPCNWMR-UQCZAKNZSA-N |
| XLogP | 6.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|