C15H22O3 — CID 46938448
(1R,2Z,6S,10S)-6-hydroxy-11,11-dimethyl-7-methylidenebicyclo[8.1.0]undec-2-ene-3-carboxylic acid (PubChem CID 46938448) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,2Z,6S,10S)-6-hydroxy-11,11-dimethyl-7-methylidenebicyclo[8.1.0]undec-2-ene-3-carboxylic acid.
| Compound Name | (1R,2Z,6S,10S)-6-hydroxy-11,11-dimethyl-7-methylidenebicyclo[8.1.0]undec-2-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 46938448 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,2Z,6S,10S)-6-hydroxy-11,11-dimethyl-7-methylidenebicyclo[8.1.0]undec-2-ene-3-carboxylic acid |
| SMILES | C=C1CC[C@H]2[C@@H](/C=C(\C(=O)O)CC[C@@H]1O)C2(C)C |
| InChI | InChI=1S/C15H22O3/c1-9-4-6-11-12(15(11,2)3)8-10(14(17)18)5-7-13(9)16/h8,11-13,16H,1,4-7H2,2-3H3,(H,17,18)/b10-8-/t11-,12+,13-/m0/s1 |
| InChIKey | UFUCTYSVQPEEFA-ZTUIHPJCSA-N |
| XLogP | 2.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|