C25H36O2 — CID 46938549
(4E,8E,10E,13E)-4,6,8,10,12-pentamethyl-14-phenyltetradeca-4,8,10,13-tetraene-3,7-diol (PubChem CID 46938549) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (4E,8E,10E,13E)-4,6,8,10,12-pentamethyl-14-phenyltetradeca-4,8,10,13-tetraene-3,7-diol.
| Compound Name | (4E,8E,10E,13E)-4,6,8,10,12-pentamethyl-14-phenyltetradeca-4,8,10,13-tetraene-3,7-diol |
|---|---|
| PubChem CID | 46938549 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (4E,8E,10E,13E)-4,6,8,10,12-pentamethyl-14-phenyltetradeca-4,8,10,13-tetraene-3,7-diol |
| SMILES | CCC(O)/C(C)=C/C(C)C(O)/C(C)=C/C(C)=C/C(C)/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H36O2/c1-7-24(26)20(4)17-22(6)25(27)21(5)16-19(3)15-18(2)13-14-23-11-9-8-10-12-23/h8-18,22,24-27H,7H2,1-6H3/b14-13+,19-15+,20-17+,21-16+ |
| InChIKey | YLFWWEOWHPOZJW-LPSDNXKQSA-N |
| XLogP | 5.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|