C24H14ClF4N3O6S — CID 46938696
3-(3-chloro-4-fluorophenyl)-5'-nitro-1,1-dioxo-1'-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,3-thiazolidine-2,3'-indole]-2',4-dione (PubChem CID 46938696) has the molecular formula C24H14ClF4N3O6S and a molecular weight of 583.90 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-5'-nitro-1,1-dioxo-1'-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,3-thiazolidine-2,3'-indole]-2',4-dione.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-5'-nitro-1,1-dioxo-1'-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,3-thiazolidine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 46938696 |
| Molecular Formula | C24H14ClF4N3O6S |
| Molecular Weight | 583.90 g/mol |
| Exact Mass | 583.02 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-5'-nitro-1,1-dioxo-1'-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,3-thiazolidine-2,3'-indole]-2',4-dione |
| SMILES | O=C1CS(=O)(=O)C2(C(=O)N(Cc3cccc(C(F)(F)F)c3)c3ccc([N+](=O)[O-])cc32)N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C24H14ClF4N3O6S/c25-18-10-15(4-6-19(18)26)31-21(33)12-39(37,38)23(31)17-9-16(32(35)36)5-7-20(17)30(22(23)34)11-13-2-1-3-14(8-13)24(27,28)29/h1-10H,11-12H2 |
| InChIKey | CIJVIAAWAHEHMT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.90 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|