About 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride
5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride (PubChem CID 46938810) has the molecular formula C19H22BrCl2N3O3
and a molecular weight of 491.21 g/mol. Its IUPAC name is 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride.
Molecular Properties
| Compound Name | 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride |
| PubChem CID | 46938810 |
| Molecular Formula | C19H22BrCl2N3O3 |
| Molecular Weight | 491.21 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride |
| SMILES | COc1ccc(-c2c(-c3cc(Br)c(OC)c(OC)c3)ncn2C)cc1N.Cl.Cl |
| InChI | InChI=1S/C19H20BrN3O3.2ClH/c1-23-10-22-17(12-7-13(20)19(26-4)16(9-12)25-3)18(23)11-5-6-15(24-2)14(21)8-11;;/h5-10H,21H2,1-4H3;2*1H |
| InChIKey | GDKMGBCYXLUWPE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.21 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride?
The IUPAC name of 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride (CID 46938810) is 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride.
What is the SMILES notation for 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride?
The canonical SMILES for 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride is COc1ccc(-c2c(-c3cc(Br)c(OC)c(OC)c3)ncn2C)cc1N.Cl.Cl.
What is the InChIKey of 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride?
The InChIKey is GDKMGBCYXLUWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20BrN3O3.2ClH/c1-23-10-22-17(12-7-13(20)19(26-4)16(9-12)25-3)18(23)11-5-6-15(24-2)14(21)8-11;;/h5-10H,21H2,1-4H3;2*1H.
What are the key properties of 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride?
5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride has a molecular weight of 491.21 g/mol, XLogP of 4.97, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(3-bromo-4,5-dimethoxyphenyl)-3-methylimidazol-4-yl]-2-methoxyaniline;dihydrochloride is sourced from PubChem (CID 46938810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).