C24H38O4Si — CID 46938966
2,3-dimethoxy-5-methyl-6-[(2E,6Z,9E)-3,7,9-trimethyl-10-trimethylsilyldeca-2,6,9-trienyl]pyran-4-one (PubChem CID 46938966) has the molecular formula C24H38O4Si and a molecular weight of 418.65 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(2E,6Z,9E)-3,7,9-trimethyl-10-trimethylsilyldeca-2,6,9-trienyl]pyran-4-one.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(2E,6Z,9E)-3,7,9-trimethyl-10-trimethylsilyldeca-2,6,9-trienyl]pyran-4-one |
|---|---|
| PubChem CID | 46938966 |
| Molecular Formula | C24H38O4Si |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(2E,6Z,9E)-3,7,9-trimethyl-10-trimethylsilyldeca-2,6,9-trienyl]pyran-4-one |
| SMILES | COc1oc(C/C=C(\C)CC/C=C(/C)C/C(C)=C/[Si](C)(C)C)c(C)c(=O)c1OC |
| InChI | InChI=1S/C24H38O4Si/c1-17(11-10-12-18(2)15-19(3)16-29(7,8)9)13-14-21-20(4)22(25)23(26-5)24(27-6)28-21/h12-13,16H,10-11,14-15H2,1-9H3/b17-13+,18-12-,19-16+ |
| InChIKey | MHCNLJMJHOFHKP-GLGNXHPJSA-N |
| XLogP | 6.39 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|