C28H38N2O3 — CID 46939154
1-[3-(furan-2-yl)-5-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 46939154) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is 1-[3-(furan-2-yl)-5-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[3-(furan-2-yl)-5-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 46939154 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 1-[3-(furan-2-yl)-5-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | CC(=O)N1N=C([C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)CC1c1ccco1 |
| InChI | InChI=1S/C28H38N2O3/c1-17(31)30-25(26-5-4-14-33-26)16-24(29-30)23-9-8-21-20-7-6-18-15-19(32)10-12-27(18,2)22(20)11-13-28(21,23)3/h4-6,14,19-23,25,32H,7-13,15-16H2,1-3H3/t19-,20-,21-,22-,23+,25?,27-,28-/m0/s1 |
| InChIKey | MRPVTYHWRAZMHD-WPCUILGGSA-N |
| XLogP | 5.87 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|