C41H33Cl2N3O3 — CID 46939437
(1R,5S,6S,11E)-1-(2-chlorophenyl)-11-[(2-chlorophenyl)methylidene]-2,9-diphenyl-13-[(1R)-1-phenylethyl]-4,7,10-trioxa-3,8,13-triazadispiro[4.0.46.45]tetradeca-2,8-diene (PubChem CID 46939437) has the molecular formula C41H33Cl2N3O3 and a molecular weight of 686.64 g/mol. Its IUPAC name is (1R,5S,6S,11E)-1-(2-chlorophenyl)-11-[(2-chlorophenyl)methylidene]-2,9-diphenyl-13-[(1R)-1-phenylethyl]-4,7,10-trioxa-3,8,13-triazadispiro[4.0.46.45]tetradeca-2,8-diene.
| Compound Name | (1R,5S,6S,11E)-1-(2-chlorophenyl)-11-[(2-chlorophenyl)methylidene]-2,9-diphenyl-13-[(1R)-1-phenylethyl]-4,7,10-trioxa-3,8,13-triazadispiro[4.0.46.45]tetradeca-2,8-diene |
|---|---|
| PubChem CID | 46939437 |
| Molecular Formula | C41H33Cl2N3O3 |
| Molecular Weight | 686.64 g/mol |
| Exact Mass | 685.19 |
| IUPAC Name | (1R,5S,6S,11E)-1-(2-chlorophenyl)-11-[(2-chlorophenyl)methylidene]-2,9-diphenyl-13-[(1R)-1-phenylethyl]-4,7,10-trioxa-3,8,13-triazadispiro[4.0.46.45]tetradeca-2,8-diene |
| SMILES | C[C@H](c1ccccc1)N1C/C(=C\c2ccccc2Cl)[C@]2(ON=C(c3ccccc3)O2)[C@]2(C1)ON=C(c1ccccc1)[C@H]2c1ccccc1Cl |
| InChI | InChI=1S/C41H33Cl2N3O3/c1-28(29-15-5-2-6-16-29)46-26-33(25-32-21-11-13-23-35(32)42)41(47-39(45-49-41)31-19-9-4-10-20-31)40(27-46)37(34-22-12-14-24-36(34)43)38(44-48-40)30-17-7-3-8-18-30/h2-25,28,37H,26-27H2,1H3/b33-25+/t28-,37-,40-,41+/m1/s1 |
| InChIKey | YWHZOTNOFNOSNV-HJTOWWCOSA-N |
| XLogP | 9.52 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.64 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |