C22H23F3N2O2 — CID 46939564
1-(3-amino-4-pyridinyl)-6-(2,3-dihydro-1-benzofuran-7-yl)-6-methyl-4-(trifluoromethyl)hept-1-yn-4-ol (PubChem CID 46939564) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-(3-amino-4-pyridinyl)-6-(2,3-dihydro-1-benzofuran-7-yl)-6-methyl-4-(trifluoromethyl)hept-1-yn-4-ol.
| Compound Name | 1-(3-amino-4-pyridinyl)-6-(2,3-dihydro-1-benzofuran-7-yl)-6-methyl-4-(trifluoromethyl)hept-1-yn-4-ol |
|---|---|
| PubChem CID | 46939564 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-(3-amino-4-pyridinyl)-6-(2,3-dihydro-1-benzofuran-7-yl)-6-methyl-4-(trifluoromethyl)hept-1-yn-4-ol |
| SMILES | CC(C)(CC(O)(CC#Cc1ccncc1N)C(F)(F)F)c1cccc2c1OCC2 |
| InChI | InChI=1S/C22H23F3N2O2/c1-20(2,17-7-3-5-16-9-12-29-19(16)17)14-21(28,22(23,24)25)10-4-6-15-8-11-27-13-18(15)26/h3,5,7-8,11,13,28H,9-10,12,14,26H2,1-2H3 |
| InChIKey | RAXOGDKGDMVXMR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|