C20H36O4 — CID 46939592
methyl (2R,3R,6R)-8-(2,2-dimethyl-6-methylidenecyclohexyl)-3,6-dihydroxy-2,6-dimethyloctanoate (PubChem CID 46939592) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is methyl (2R,3R,6R)-8-(2,2-dimethyl-6-methylidenecyclohexyl)-3,6-dihydroxy-2,6-dimethyloctanoate.
| Compound Name | methyl (2R,3R,6R)-8-(2,2-dimethyl-6-methylidenecyclohexyl)-3,6-dihydroxy-2,6-dimethyloctanoate |
|---|---|
| PubChem CID | 46939592 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | methyl (2R,3R,6R)-8-(2,2-dimethyl-6-methylidenecyclohexyl)-3,6-dihydroxy-2,6-dimethyloctanoate |
| SMILES | C=C1CCCC(C)(C)C1CC[C@@](C)(O)CC[C@@H](O)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C20H36O4/c1-14-8-7-11-19(3,4)16(14)9-12-20(5,23)13-10-17(21)15(2)18(22)24-6/h15-17,21,23H,1,7-13H2,2-6H3/t15-,16?,17-,20-/m1/s1 |
| InChIKey | OKRBMWPDGMFNRO-CYXPSIDGSA-N |
| XLogP | 3.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|