C17H16O5 — CID 46939683
(3aR,4S,7S,9bR)-4-hydroxy-7-phenyl-3a,4,5,7,8,9b-hexahydro-1H-furo[3,2-f]chromene-2,9-dione (PubChem CID 46939683) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is (3aR,4S,7S,9bR)-4-hydroxy-7-phenyl-3a,4,5,7,8,9b-hexahydro-1H-furo[3,2-f]chromene-2,9-dione.
| Compound Name | (3aR,4S,7S,9bR)-4-hydroxy-7-phenyl-3a,4,5,7,8,9b-hexahydro-1H-furo[3,2-f]chromene-2,9-dione |
|---|---|
| PubChem CID | 46939683 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (3aR,4S,7S,9bR)-4-hydroxy-7-phenyl-3a,4,5,7,8,9b-hexahydro-1H-furo[3,2-f]chromene-2,9-dione |
| SMILES | O=C1C[C@@H]2C3=C(C[C@H](O)[C@@H]2O1)O[C@H](c1ccccc1)CC3=O |
| InChI | InChI=1S/C17H16O5/c18-11-7-13(9-4-2-1-3-5-9)21-14-8-12(19)17-10(16(11)14)6-15(20)22-17/h1-5,10,12-13,17,19H,6-8H2/t10-,12+,13+,17-/m1/s1 |
| InChIKey | LCYOEQRSFIXYFW-FIHUPRISSA-N |
| XLogP | 1.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |