C22H24O4 — CID 46939771
6,8,8-triethyl-5-hydroxy-2-(3-methylphenyl)chromene-4,7-dione (PubChem CID 46939771) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 6,8,8-triethyl-5-hydroxy-2-(3-methylphenyl)chromene-4,7-dione.
| Compound Name | 6,8,8-triethyl-5-hydroxy-2-(3-methylphenyl)chromene-4,7-dione |
|---|---|
| PubChem CID | 46939771 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 6,8,8-triethyl-5-hydroxy-2-(3-methylphenyl)chromene-4,7-dione |
| SMILES | CCC1=C(O)c2c(oc(-c3cccc(C)c3)cc2=O)C(CC)(CC)C1=O |
| InChI | InChI=1S/C22H24O4/c1-5-15-19(24)18-16(23)12-17(14-10-8-9-13(4)11-14)26-21(18)22(6-2,7-3)20(15)25/h8-12,24H,5-7H2,1-4H3 |
| InChIKey | NOKPHDVPXGPGOI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |