C21H21FO4 — CID 46939865
6,8,8-triethyl-2-(2-fluorophenyl)-5-hydroxychromene-4,7-dione (PubChem CID 46939865) has the molecular formula C21H21FO4 and a molecular weight of 356.39 g/mol. Its IUPAC name is 6,8,8-triethyl-2-(2-fluorophenyl)-5-hydroxychromene-4,7-dione.
| Compound Name | 6,8,8-triethyl-2-(2-fluorophenyl)-5-hydroxychromene-4,7-dione |
|---|---|
| PubChem CID | 46939865 |
| Molecular Formula | C21H21FO4 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 6,8,8-triethyl-2-(2-fluorophenyl)-5-hydroxychromene-4,7-dione |
| SMILES | CCC1=C(O)c2c(oc(-c3ccccc3F)cc2=O)C(CC)(CC)C1=O |
| InChI | InChI=1S/C21H21FO4/c1-4-12-18(24)17-15(23)11-16(13-9-7-8-10-14(13)22)26-20(17)21(5-2,6-3)19(12)25/h7-11,24H,4-6H2,1-3H3 |
| InChIKey | YBIPNWFASFUTFG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |