C15H20O3 — CID 46939891
(1R,4R,6R,9E,11S)-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene-4,9-dicarbaldehyde (PubChem CID 46939891) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1R,4R,6R,9E,11S)-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene-4,9-dicarbaldehyde.
| Compound Name | (1R,4R,6R,9E,11S)-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene-4,9-dicarbaldehyde |
|---|---|
| PubChem CID | 46939891 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1R,4R,6R,9E,11S)-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-ene-4,9-dicarbaldehyde |
| SMILES | CC1(C)[C@@H]2CC[C@@]3(C=O)O[C@@H]3CC/C(C=O)=C\[C@@H]21 |
| InChI | InChI=1S/C15H20O3/c1-14(2)11-5-6-15(9-17)13(18-15)4-3-10(8-16)7-12(11)14/h7-9,11-13H,3-6H2,1-2H3/b10-7+/t11-,12+,13-,15+/m1/s1 |
| InChIKey | UOBZWMPWXPIGBV-MKGHMRODSA-N |
| XLogP | 2.29 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|