C18H23ClN2O2 — CID 46940157
N-[4-chloro-1-(hydroxymethyl)indol-3-yl]-3-cyclohexylpropanamide (PubChem CID 46940157) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is N-[4-chloro-1-(hydroxymethyl)indol-3-yl]-3-cyclohexylpropanamide.
| Compound Name | N-[4-chloro-1-(hydroxymethyl)indol-3-yl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 46940157 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-[4-chloro-1-(hydroxymethyl)indol-3-yl]-3-cyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)Nc1cn(CO)c2cccc(Cl)c12 |
| InChI | InChI=1S/C18H23ClN2O2/c19-14-7-4-8-16-18(14)15(11-21(16)12-22)20-17(23)10-9-13-5-2-1-3-6-13/h4,7-8,11,13,22H,1-3,5-6,9-10,12H2,(H,20,23) |
| InChIKey | CPACRRVJKRXGDW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |