C36H32N6O3 — CID 46940327
2-[[1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidin-4-yl]carbamoyl]benzoic acid (PubChem CID 46940327) has the molecular formula C36H32N6O3 and a molecular weight of 596.69 g/mol. Its IUPAC name is 2-[[1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidin-4-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidin-4-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 46940327 |
| Molecular Formula | C36H32N6O3 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 2-[[1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidin-4-yl]carbamoyl]benzoic acid |
| SMILES | Cc1cc2ncc3cc(-c4ccccc4)c(-c4ccc(CN5CCC(NC(=O)c6ccccc6C(=O)O)CC5)cc4)nc3n2n1 |
| InChI | InChI=1S/C36H32N6O3/c1-23-19-32-37-21-27-20-31(25-7-3-2-4-8-25)33(39-34(27)42(32)40-23)26-13-11-24(12-14-26)22-41-17-15-28(16-18-41)38-35(43)29-9-5-6-10-30(29)36(44)45/h2-14,19-21,28H,15-18,22H2,1H3,(H,38,43)(H,44,45) |
| InChIKey | JNDDBYFTMGBCQG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 112.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |