C22H17Cl2F3N2O3 — CID 46940382
4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]anilino]benzoic acid (PubChem CID 46940382) has the molecular formula C22H17Cl2F3N2O3 and a molecular weight of 485.29 g/mol. Its IUPAC name is 4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]anilino]benzoic acid.
| Compound Name | 4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]anilino]benzoic acid |
|---|---|
| PubChem CID | 46940382 |
| Molecular Formula | C22H17Cl2F3N2O3 |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]anilino]benzoic acid |
| SMILES | CC(c1ccc(Nc2ccc(C(=O)O)cc2)cc1Cl)C(O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C22H17Cl2F3N2O3/c1-12(21(32,22(25,26)27)14-8-9-28-19(24)10-14)17-7-6-16(11-18(17)23)29-15-4-2-13(3-5-15)20(30)31/h2-12,29,32H,1H3,(H,30,31) |
| InChIKey | PNWZHUHPJQUIEZ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|