C23H18Cl2F3NO4 — CID 46940465
2-[4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]phenyl]acetic acid (PubChem CID 46940465) has the molecular formula C23H18Cl2F3NO4 and a molecular weight of 500.30 g/mol. Its IUPAC name is 2-[4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 46940465 |
| Molecular Formula | C23H18Cl2F3NO4 |
| Molecular Weight | 500.30 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-[4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]phenyl]acetic acid |
| SMILES | CC(c1ccc(Oc2ccc(CC(=O)O)cc2)cc1Cl)C(O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C23H18Cl2F3NO4/c1-13(22(32,23(26,27)28)15-8-9-29-20(25)11-15)18-7-6-17(12-19(18)24)33-16-4-2-14(3-5-16)10-21(30)31/h2-9,11-13,32H,10H2,1H3,(H,30,31) |
| InChIKey | GEHYUFCIISFKPT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.30 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|