C25H24ClF3N2O5 — CID 46940640
methyl 4-[2-[3-chloro-4-[4,4,4-trifluoro-3-hydroxy-3-(5-methylpyrazin-2-yl)butan-2-yl]phenoxy]ethoxy]benzoate (PubChem CID 46940640) has the molecular formula C25H24ClF3N2O5 and a molecular weight of 524.92 g/mol. Its IUPAC name is methyl 4-[2-[3-chloro-4-[4,4,4-trifluoro-3-hydroxy-3-(5-methylpyrazin-2-yl)butan-2-yl]phenoxy]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[3-chloro-4-[4,4,4-trifluoro-3-hydroxy-3-(5-methylpyrazin-2-yl)butan-2-yl]phenoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 46940640 |
| Molecular Formula | C25H24ClF3N2O5 |
| Molecular Weight | 524.92 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | methyl 4-[2-[3-chloro-4-[4,4,4-trifluoro-3-hydroxy-3-(5-methylpyrazin-2-yl)butan-2-yl]phenoxy]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCOc2ccc(C(C)C(O)(c3cnc(C)cn3)C(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H24ClF3N2O5/c1-15-13-31-22(14-30-15)24(33,25(27,28)29)16(2)20-9-8-19(12-21(20)26)36-11-10-35-18-6-4-17(5-7-18)23(32)34-3/h4-9,12-14,16,33H,10-11H2,1-3H3 |
| InChIKey | APLWYEHGJQVQPW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.92 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|