About 1-butyl-3-(3,4-dichlorophenyl)urea
1-butyl-3-(3,4-dichlorophenyl)urea (PubChem CID 4694080) has the molecular formula C11H14Cl2N2O
and a molecular weight of 261.15 g/mol. Its IUPAC name is 1-butyl-3-(3,4-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-butyl-3-(3,4-dichlorophenyl)urea |
| PubChem CID | 4694080 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-butyl-3-(3,4-dichlorophenyl)urea |
| SMILES | CCCCNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O/c1-2-3-6-14-11(16)15-8-4-5-9(12)10(13)7-8/h4-5,7H,2-3,6H2,1H3,(H2,14,15,16) |
| InChIKey | WMFQAMIRKIKODI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-(3,4-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-(3,4-dichlorophenyl)urea?
The IUPAC name of 1-butyl-3-(3,4-dichlorophenyl)urea (CID 4694080) is 1-butyl-3-(3,4-dichlorophenyl)urea.
What is the SMILES notation for 1-butyl-3-(3,4-dichlorophenyl)urea?
The canonical SMILES for 1-butyl-3-(3,4-dichlorophenyl)urea is CCCCNC(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-butyl-3-(3,4-dichlorophenyl)urea?
The InChIKey is WMFQAMIRKIKODI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2N2O/c1-2-3-6-14-11(16)15-8-4-5-9(12)10(13)7-8/h4-5,7H,2-3,6H2,1H3,(H2,14,15,16).
What are the key properties of 1-butyl-3-(3,4-dichlorophenyl)urea?
1-butyl-3-(3,4-dichlorophenyl)urea has a molecular weight of 261.15 g/mol, XLogP of 3.91, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-(3,4-dichlorophenyl)urea is sourced from PubChem (CID 4694080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).