C36H34N6O2 — CID 46941034
2-[(3-aminophenyl)methyl]-1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 46941034) has the molecular formula C36H34N6O2 and a molecular weight of 582.71 g/mol. Its IUPAC name is 2-[(3-aminophenyl)methyl]-1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 2-[(3-aminophenyl)methyl]-1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 46941034 |
| Molecular Formula | C36H34N6O2 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 2-[(3-aminophenyl)methyl]-1-[[4-(4-methyl-11-phenyl-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl)phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | Cc1cc2ncc3cc(-c4ccccc4)c(-c4ccc(CN5CCC(C(=O)O)CC5Cc5cccc(N)c5)cc4)nc3n2n1 |
| InChI | InChI=1S/C36H34N6O2/c1-23-16-33-38-21-29-20-32(26-7-3-2-4-8-26)34(39-35(29)42(33)40-23)27-12-10-24(11-13-27)22-41-15-14-28(36(43)44)19-31(41)18-25-6-5-9-30(37)17-25/h2-13,16-17,20-21,28,31H,14-15,18-19,22,37H2,1H3,(H,43,44) |
| InChIKey | ZBSHVMGCEBTCDL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|