C24H19Cl2F3N2O4 — CID 46941093
4-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoyl]-methylamino]benzoic acid (PubChem CID 46941093) has the molecular formula C24H19Cl2F3N2O4 and a molecular weight of 527.33 g/mol. Its IUPAC name is 4-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoyl]-methylamino]benzoic acid.
| Compound Name | 4-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoyl]-methylamino]benzoic acid |
|---|---|
| PubChem CID | 46941093 |
| Molecular Formula | C24H19Cl2F3N2O4 |
| Molecular Weight | 527.33 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 4-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoyl]-methylamino]benzoic acid |
| SMILES | CC(c1ccc(C(=O)N(C)c2ccc(C(=O)O)cc2)cc1Cl)C(O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C24H19Cl2F3N2O4/c1-13(23(35,24(27,28)29)16-9-10-30-20(26)12-16)18-8-5-15(11-19(18)25)21(32)31(2)17-6-3-14(4-7-17)22(33)34/h3-13,35H,1-2H3,(H,33,34) |
| InChIKey | JDHCXNZYGGBLQL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.33 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|