C25H21Cl2F3N2O4 — CID 46941181
methyl 2-[4-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoyl]amino]phenyl]acetate (PubChem CID 46941181) has the molecular formula C25H21Cl2F3N2O4 and a molecular weight of 541.35 g/mol. Its IUPAC name is methyl 2-[4-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[4-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 46941181 |
| Molecular Formula | C25H21Cl2F3N2O4 |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | methyl 2-[4-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoyl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(=O)c2ccc(C(C)C(O)(c3ccnc(Cl)c3)C(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H21Cl2F3N2O4/c1-14(24(35,25(28,29)30)17-9-10-31-21(27)13-17)19-8-5-16(12-20(19)26)23(34)32-18-6-3-15(4-7-18)11-22(33)36-2/h3-10,12-14,35H,11H2,1-2H3,(H,32,34) |
| InChIKey | XOORNXSCMPYOLN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|