C15H31NS2 — CID 46941523
2,4,6-tris(2-methylpropyl)-1,3,5-dithiazinane (PubChem CID 46941523) has the molecular formula C15H31NS2 and a molecular weight of 289.55 g/mol. Its IUPAC name is 2,4,6-tris(2-methylpropyl)-1,3,5-dithiazinane.
| Compound Name | 2,4,6-tris(2-methylpropyl)-1,3,5-dithiazinane |
|---|---|
| PubChem CID | 46941523 |
| Molecular Formula | C15H31NS2 |
| Molecular Weight | 289.55 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 2,4,6-tris(2-methylpropyl)-1,3,5-dithiazinane |
| SMILES | CC(C)CC1NC(CC(C)C)SC(CC(C)C)S1 |
| InChI | InChI=1S/C15H31NS2/c1-10(2)7-13-16-14(8-11(3)4)18-15(17-13)9-12(5)6/h10-16H,7-9H2,1-6H3 |
| InChIKey | RQGPQWUKHADVPF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |