About 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole
3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole (PubChem CID 46941780) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole |
| PubChem CID | 46941780 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole |
| SMILES | CC1(C)CNc2ccc(S(C)(=O)=O)cc21 |
| InChI | InChI=1S/C11H15NO2S/c1-11(2)7-12-10-5-4-8(6-9(10)11)15(3,13)14/h4-6,12H,7H2,1-3H3 |
| InChIKey | HSJAYSJUFNOUNK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole?
The IUPAC name of 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole (CID 46941780) is 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole.
What is the SMILES notation for 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole?
The canonical SMILES for 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole is CC1(C)CNc2ccc(S(C)(=O)=O)cc21.
What is the InChIKey of 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole?
The InChIKey is HSJAYSJUFNOUNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-11(2)7-12-10-5-4-8(6-9(10)11)15(3,13)14/h4-6,12H,7H2,1-3H3.
What are the key properties of 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole?
3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole has a molecular weight of 225.31 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-5-methylsulfonyl-1,2-dihydroindole is sourced from PubChem (CID 46941780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).