C11H14N2O6 — CID 46942076
ethyl 4-nitro-3-(oxolan-2-ylmethyl)-1,2-oxazole-5-carboxylate (PubChem CID 46942076) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is ethyl 4-nitro-3-(oxolan-2-ylmethyl)-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 4-nitro-3-(oxolan-2-ylmethyl)-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 46942076 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | ethyl 4-nitro-3-(oxolan-2-ylmethyl)-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1onc(CC2CCCO2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O6/c1-2-17-11(14)10-9(13(15)16)8(12-19-10)6-7-4-3-5-18-7/h7H,2-6H2,1H3 |
| InChIKey | VLPRAWRVHGHIOX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|