About 5,7-dichloroimidazo[1,2-c]pyrimidine
5,7-dichloroimidazo[1,2-c]pyrimidine (PubChem CID 46942117) has the molecular formula C6H3Cl2N3
and a molecular weight of 188.02 g/mol. Its IUPAC name is 5,7-dichloroimidazo[1,2-c]pyrimidine.
Molecular Properties
| Compound Name | 5,7-dichloroimidazo[1,2-c]pyrimidine |
| PubChem CID | 46942117 |
| Molecular Formula | C6H3Cl2N3 |
| Molecular Weight | 188.02 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 5,7-dichloroimidazo[1,2-c]pyrimidine |
| SMILES | Clc1cc2nccn2c(Cl)n1 |
| InChI | InChI=1S/C6H3Cl2N3/c7-4-3-5-9-1-2-11(5)6(8)10-4/h1-3H |
| InChIKey | QMTXTHVMSRFISO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.02 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dichloroimidazo[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloroimidazo[1,2-c]pyrimidine?
The IUPAC name of 5,7-dichloroimidazo[1,2-c]pyrimidine (CID 46942117) is 5,7-dichloroimidazo[1,2-c]pyrimidine.
What is the SMILES notation for 5,7-dichloroimidazo[1,2-c]pyrimidine?
The canonical SMILES for 5,7-dichloroimidazo[1,2-c]pyrimidine is Clc1cc2nccn2c(Cl)n1.
What is the InChIKey of 5,7-dichloroimidazo[1,2-c]pyrimidine?
The InChIKey is QMTXTHVMSRFISO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2N3/c7-4-3-5-9-1-2-11(5)6(8)10-4/h1-3H.
What are the key properties of 5,7-dichloroimidazo[1,2-c]pyrimidine?
5,7-dichloroimidazo[1,2-c]pyrimidine has a molecular weight of 188.02 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloroimidazo[1,2-c]pyrimidine is sourced from PubChem (CID 46942117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).