About 2-(diethoxymethyl)-1,3-oxazole
2-(diethoxymethyl)-1,3-oxazole (PubChem CID 46942154) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(diethoxymethyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(diethoxymethyl)-1,3-oxazole |
| PubChem CID | 46942154 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 2-(diethoxymethyl)-1,3-oxazole |
| SMILES | CCOC(OCC)c1ncco1 |
| InChI | InChI=1S/C8H13NO3/c1-3-10-8(11-4-2)7-9-5-6-12-7/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | JMXBSNIVSPBLKD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethoxymethyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethoxymethyl)-1,3-oxazole?
The IUPAC name of 2-(diethoxymethyl)-1,3-oxazole (CID 46942154) is 2-(diethoxymethyl)-1,3-oxazole.
What is the SMILES notation for 2-(diethoxymethyl)-1,3-oxazole?
The canonical SMILES for 2-(diethoxymethyl)-1,3-oxazole is CCOC(OCC)c1ncco1.
What is the InChIKey of 2-(diethoxymethyl)-1,3-oxazole?
The InChIKey is JMXBSNIVSPBLKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-3-10-8(11-4-2)7-9-5-6-12-7/h5-6,8H,3-4H2,1-2H3.
What are the key properties of 2-(diethoxymethyl)-1,3-oxazole?
2-(diethoxymethyl)-1,3-oxazole has a molecular weight of 171.20 g/mol, XLogP of 1.75, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethoxymethyl)-1,3-oxazole is sourced from PubChem (CID 46942154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).