About 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine]
5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine] (PubChem CID 46942192) has the molecular formula C12H14BrN
and a molecular weight of 252.15 g/mol. Its IUPAC name is 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine].
Molecular Properties
| Compound Name | 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine] |
| PubChem CID | 46942192 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine] |
| SMILES | Brc1ccc2c(c1)C1(CCCN1)CC2 |
| InChI | InChI=1S/C12H14BrN/c13-10-3-2-9-4-6-12(11(9)8-10)5-1-7-14-12/h2-3,8,14H,1,4-7H2 |
| InChIKey | CZJDTQVZRCZNOG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine]?
The IUPAC name of 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine] (CID 46942192) is 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine].
What is the SMILES notation for 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine]?
The canonical SMILES for 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine] is Brc1ccc2c(c1)C1(CCCN1)CC2.
What is the InChIKey of 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine]?
The InChIKey is CZJDTQVZRCZNOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN/c13-10-3-2-9-4-6-12(11(9)8-10)5-1-7-14-12/h2-3,8,14H,1,4-7H2.
What are the key properties of 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine]?
5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine] has a molecular weight of 252.15 g/mol, XLogP of 2.97, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromospiro[1,2-dihydroindene-3,2'-pyrrolidine] is sourced from PubChem (CID 46942192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).