About ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate
ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate (PubChem CID 46942570) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate |
| PubChem CID | 46942570 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate |
| SMILES | CCOC(=O)C1(C)CCN1C(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C14H19NO4/c1-5-18-13(17)14(4)6-7-15(14)12(16)11-8-9(2)19-10(11)3/h8H,5-7H2,1-4H3 |
| InChIKey | ZSQAUZIEXPLHIZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate?
The IUPAC name of ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate (CID 46942570) is ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate.
What is the SMILES notation for ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate?
The canonical SMILES for ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate is CCOC(=O)C1(C)CCN1C(=O)c1cc(C)oc1C.
What is the InChIKey of ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate?
The InChIKey is ZSQAUZIEXPLHIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-5-18-13(17)14(4)6-7-15(14)12(16)11-8-9(2)19-10(11)3/h8H,5-7H2,1-4H3.
What are the key properties of ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate?
ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate has a molecular weight of 265.31 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,5-dimethylfuran-3-carbonyl)-2-methylazetidine-2-carboxylate is sourced from PubChem (CID 46942570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).