About 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol
1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol (PubChem CID 46942582) has the molecular formula C21H23NO2S
and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol.
Molecular Properties
| Compound Name | 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol |
| PubChem CID | 46942582 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol |
| SMILES | COc1cccc(C(C)(O)c2nc(-c3cccc(C(C)C)c3)cs2)c1 |
| InChI | InChI=1S/C21H23NO2S/c1-14(2)15-7-5-8-16(11-15)19-13-25-20(22-19)21(3,23)17-9-6-10-18(12-17)24-4/h5-14,23H,1-4H3 |
| InChIKey | BBDSOEGCNZOTKX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol?
The IUPAC name of 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol (CID 46942582) is 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol.
What is the SMILES notation for 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol?
The canonical SMILES for 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol is COc1cccc(C(C)(O)c2nc(-c3cccc(C(C)C)c3)cs2)c1.
What is the InChIKey of 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol?
The InChIKey is BBDSOEGCNZOTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO2S/c1-14(2)15-7-5-8-16(11-15)19-13-25-20(22-19)21(3,23)17-9-6-10-18(12-17)24-4/h5-14,23H,1-4H3.
What are the key properties of 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol?
1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol has a molecular weight of 353.49 g/mol, XLogP of 5.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxyphenyl)-1-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]ethanol is sourced from PubChem (CID 46942582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).