About (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol
(3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol (PubChem CID 46942642) has the molecular formula C19H17F2NOS
and a molecular weight of 345.41 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol.
Molecular Properties
| Compound Name | (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol |
| PubChem CID | 46942642 |
| Molecular Formula | C19H17F2NOS |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol |
| SMILES | CC(C)c1cccc(-c2csc(C(O)c3ccc(F)c(F)c3)n2)c1 |
| InChI | InChI=1S/C19H17F2NOS/c1-11(2)12-4-3-5-13(8-12)17-10-24-19(22-17)18(23)14-6-7-15(20)16(21)9-14/h3-11,18,23H,1-2H3 |
| InChIKey | NBDOHHMZYVHRSO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol?
The IUPAC name of (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol (CID 46942642) is (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol.
What is the SMILES notation for (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol?
The canonical SMILES for (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol is CC(C)c1cccc(-c2csc(C(O)c3ccc(F)c(F)c3)n2)c1.
What is the InChIKey of (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol?
The InChIKey is NBDOHHMZYVHRSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2NOS/c1-11(2)12-4-3-5-13(8-12)17-10-24-19(22-17)18(23)14-6-7-15(20)16(21)9-14/h3-11,18,23H,1-2H3.
What are the key properties of (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol?
(3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol has a molecular weight of 345.41 g/mol, XLogP of 5.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorophenyl)-[4-(3-propan-2-ylphenyl)-1,3-thiazol-2-yl]methanol is sourced from PubChem (CID 46942642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).