C22H26N6OS — CID 46942674
2-ethyl-N-(3-imidazol-1-ylpropyl)-3-[methyl(thiophen-2-ylmethyl)amino]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 46942674) has the molecular formula C22H26N6OS and a molecular weight of 422.56 g/mol. Its IUPAC name is 2-ethyl-N-(3-imidazol-1-ylpropyl)-3-[methyl(thiophen-2-ylmethyl)amino]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 2-ethyl-N-(3-imidazol-1-ylpropyl)-3-[methyl(thiophen-2-ylmethyl)amino]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 46942674 |
| Molecular Formula | C22H26N6OS |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-ethyl-N-(3-imidazol-1-ylpropyl)-3-[methyl(thiophen-2-ylmethyl)amino]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCc1nc2ccc(C(=O)NCCCn3ccnc3)cn2c1N(C)Cc1cccs1 |
| InChI | InChI=1S/C22H26N6OS/c1-3-19-22(26(2)15-18-6-4-13-30-18)28-14-17(7-8-20(28)25-19)21(29)24-9-5-11-27-12-10-23-16-27/h4,6-8,10,12-14,16H,3,5,9,11,15H2,1-2H3,(H,24,29) |
| InChIKey | XDBNFTWALJKQFJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|