C14H18FNO7 — CID 46942796
(2R,3R,4S,5R,6R)-N-(3-fluoro-4-methoxyphenyl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide (PubChem CID 46942796) has the molecular formula C14H18FNO7 and a molecular weight of 331.30 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-N-(3-fluoro-4-methoxyphenyl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R,6R)-N-(3-fluoro-4-methoxyphenyl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 46942796 |
| Molecular Formula | C14H18FNO7 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2R,3R,4S,5R,6R)-N-(3-fluoro-4-methoxyphenyl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C14H18FNO7/c1-22-8-3-2-6(4-7(8)15)16-14(21)13-12(20)11(19)10(18)9(5-17)23-13/h2-4,9-13,17-20H,5H2,1H3,(H,16,21)/t9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | LIAQFDCJDMQHCV-KSSYENDESA-N |
| XLogP | -1.38 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |