About 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol
1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol (PubChem CID 46942839) has the molecular formula C18H15F2NO3S2
and a molecular weight of 395.45 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol |
| PubChem CID | 46942839 |
| Molecular Formula | C18H15F2NO3S2 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol |
| SMILES | CC(O)(c1ccc(F)c(F)c1)c1nc(-c2ccc(S(C)(=O)=O)cc2)cs1 |
| InChI | InChI=1S/C18H15F2NO3S2/c1-18(22,12-5-8-14(19)15(20)9-12)17-21-16(10-25-17)11-3-6-13(7-4-11)26(2,23)24/h3-10,22H,1-2H3 |
| InChIKey | UIISLLUPGABHKX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol?
The IUPAC name of 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol (CID 46942839) is 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol.
What is the SMILES notation for 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol?
The canonical SMILES for 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol is CC(O)(c1ccc(F)c(F)c1)c1nc(-c2ccc(S(C)(=O)=O)cc2)cs1.
What is the InChIKey of 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol?
The InChIKey is UIISLLUPGABHKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F2NO3S2/c1-18(22,12-5-8-14(19)15(20)9-12)17-21-16(10-25-17)11-3-6-13(7-4-11)26(2,23)24/h3-10,22H,1-2H3.
What are the key properties of 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol?
1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol has a molecular weight of 395.45 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]ethanol is sourced from PubChem (CID 46942839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).