C26H27ClN4O2 — CID 46942952
4-(4-chlorophenyl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2,3-dihydrofuro[2,3-b]pyridine-2-carboxamide (PubChem CID 46942952) has the molecular formula C26H27ClN4O2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2,3-dihydrofuro[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2,3-dihydrofuro[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 46942952 |
| Molecular Formula | C26H27ClN4O2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2,3-dihydrofuro[2,3-b]pyridine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)C3Cc4c(-c5ccc(Cl)cc5)ccnc4O3)cc2)CC1 |
| InChI | InChI=1S/C26H27ClN4O2/c1-30-12-14-31(15-13-30)21-8-2-18(3-9-21)17-29-25(32)24-16-23-22(10-11-28-26(23)33-24)19-4-6-20(27)7-5-19/h2-11,24H,12-17H2,1H3,(H,29,32) |
| InChIKey | HXDYZMOLRQBQJZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|