About 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol
1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol (PubChem CID 46942956) has the molecular formula C18H12F5NOS
and a molecular weight of 385.36 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol |
| PubChem CID | 46942956 |
| Molecular Formula | C18H12F5NOS |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol |
| SMILES | CC(O)(c1ccc(F)c(F)c1)c1nc(-c2cccc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C18H12F5NOS/c1-17(25,11-5-6-13(19)14(20)8-11)16-24-15(9-26-16)10-3-2-4-12(7-10)18(21,22)23/h2-9,25H,1H3 |
| InChIKey | KWQUSCJFUSEKAC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol?
The IUPAC name of 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol (CID 46942956) is 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol.
What is the SMILES notation for 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol?
The canonical SMILES for 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol is CC(O)(c1ccc(F)c(F)c1)c1nc(-c2cccc(C(F)(F)F)c2)cs1.
What is the InChIKey of 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol?
The InChIKey is KWQUSCJFUSEKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F5NOS/c1-17(25,11-5-6-13(19)14(20)8-11)16-24-15(9-26-16)10-3-2-4-12(7-10)18(21,22)23/h2-9,25H,1H3.
What are the key properties of 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol?
1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol has a molecular weight of 385.36 g/mol, XLogP of 5.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-1-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]ethanol is sourced from PubChem (CID 46942956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).