About 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine
2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 46942991) has the molecular formula C24H26N4O
and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine |
| PubChem CID | 46942991 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CC(C)Cc1ccc(-c2cc3nc(NCCOc4ccccc4)ccn3n2)cc1 |
| InChI | InChI=1S/C24H26N4O/c1-18(2)16-19-8-10-20(11-9-19)22-17-24-26-23(12-14-28(24)27-22)25-13-15-29-21-6-4-3-5-7-21/h3-12,14,17-18H,13,15-16H2,1-2H3,(H,25,26) |
| InChIKey | VOENLJGERVKCTL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine?
The IUPAC name of 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine (CID 46942991) is 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine.
What is the SMILES notation for 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine?
The canonical SMILES for 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine is CC(C)Cc1ccc(-c2cc3nc(NCCOc4ccccc4)ccn3n2)cc1.
What is the InChIKey of 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine?
The InChIKey is VOENLJGERVKCTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4O/c1-18(2)16-19-8-10-20(11-9-19)22-17-24-26-23(12-14-28(24)27-22)25-13-15-29-21-6-4-3-5-7-21/h3-12,14,17-18H,13,15-16H2,1-2H3,(H,25,26).
What are the key properties of 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine?
2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine has a molecular weight of 386.50 g/mol, XLogP of 5.09, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-methylpropyl)phenyl]-N-(2-phenoxyethyl)pyrazolo[1,5-a]pyrimidin-5-amine is sourced from PubChem (CID 46942991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).