About [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol
[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol (PubChem CID 46943021) has the molecular formula C18H13NO2S
and a molecular weight of 307.37 g/mol. Its IUPAC name is [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol.
Molecular Properties
| Compound Name | [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol |
| PubChem CID | 46943021 |
| Molecular Formula | C18H13NO2S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol |
| SMILES | OC(c1ccccc1)c1nc(-c2cc3ccccc3o2)cs1 |
| InChI | InChI=1S/C18H13NO2S/c20-17(12-6-2-1-3-7-12)18-19-14(11-22-18)16-10-13-8-4-5-9-15(13)21-16/h1-11,17,20H |
| InChIKey | OIRXSMKGKVEOGS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol?
The IUPAC name of [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol (CID 46943021) is [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol.
What is the SMILES notation for [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol?
The canonical SMILES for [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol is OC(c1ccccc1)c1nc(-c2cc3ccccc3o2)cs1.
What is the InChIKey of [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol?
The InChIKey is OIRXSMKGKVEOGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO2S/c20-17(12-6-2-1-3-7-12)18-19-14(11-22-18)16-10-13-8-4-5-9-15(13)21-16/h1-11,17,20H.
What are the key properties of [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol?
[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol has a molecular weight of 307.37 g/mol, XLogP of 4.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-phenylmethanol is sourced from PubChem (CID 46943021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).