About 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol
1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol (PubChem CID 46943544) has the molecular formula C18H14F3NO2S
and a molecular weight of 365.38 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol |
| PubChem CID | 46943544 |
| Molecular Formula | C18H14F3NO2S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol |
| SMILES | COc1cc(F)ccc1-c1csc(C(C)(O)c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C18H14F3NO2S/c1-18(23,10-3-6-13(20)14(21)7-10)17-22-15(9-25-17)12-5-4-11(19)8-16(12)24-2/h3-9,23H,1-2H3 |
| InChIKey | QKTRUHMDQCZELI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol?
The IUPAC name of 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol (CID 46943544) is 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol.
What is the SMILES notation for 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol?
The canonical SMILES for 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol is COc1cc(F)ccc1-c1csc(C(C)(O)c2ccc(F)c(F)c2)n1.
What is the InChIKey of 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol?
The InChIKey is QKTRUHMDQCZELI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3NO2S/c1-18(23,10-3-6-13(20)14(21)7-10)17-22-15(9-25-17)12-5-4-11(19)8-16(12)24-2/h3-9,23H,1-2H3.
What are the key properties of 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol?
1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol has a molecular weight of 365.38 g/mol, XLogP of 4.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]ethanol is sourced from PubChem (CID 46943544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).